EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O5 |
| Net Charge | 0 |
| Average Mass | 448.644 |
| Monoisotopic Mass | 448.31887 |
| SMILES | [H][C@@]12C[C@@H](O)[C@@]3([H])C[C@@H](O)[C@H](O)C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])O[C@]3(CC[C@@H](C)CO3)[C@@H](C)[C@]12[H] |
| InChI | InChI=1S/C27H44O5/c1-14-5-8-27(31-13-14)15(2)24-23(32-27)11-18-16-9-20(28)19-10-21(29)22(30)12-26(19,4)17(16)6-7-25(18,24)3/h14-24,28-30H,5-13H2,1-4H3/t14-,15+,16-,17+,18+,19-,20-,21-,22-,23+,24+,25+,26-,27-/m1/s1 |
| InChIKey | FYRLHXNMINIDCB-LEGLVIAUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| agigenin (CHEBI:72849) has parent hydride (25R)-5α-spirostan (CHEBI:35539) |
| agigenin (CHEBI:72849) has role antineoplastic agent (CHEBI:35610) |
| agigenin (CHEBI:72849) has role metabolite (CHEBI:25212) |
| agigenin (CHEBI:72849) is a 2α-hydroxy steroid (CHEBI:36858) |
| agigenin (CHEBI:72849) is a 3β-hydroxy steroid (CHEBI:36836) |
| agigenin (CHEBI:72849) is a organic heterohexacyclic compound (CHEBI:51914) |
| agigenin (CHEBI:72849) is a oxaspiro compound (CHEBI:37948) |
| Incoming Relation(s) |
| leucospiroside A (CHEBI:66574) has functional parent agigenin (CHEBI:72849) |
| IUPAC Name |
|---|
| (2α,3β,5α,6β,25R)-spirostan-2,3,6-triol |
| Manual Xrefs | Databases |
|---|---|
| LMST01080015 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4821095 | Reaxys |
| CAS:55332-76-8 | ChemIDplus |
| Citations |
|---|