EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O3 |
| Net Charge | 0 |
| Average Mass | 322.489 |
| Monoisotopic Mass | 322.25079 |
| SMILES | CCCCCC(=O)/C=C/C=C\CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C20H34O3/c1-2-3-13-16-19(21)17-14-11-9-7-5-4-6-8-10-12-15-18-20(22)23/h9,11,14,17H,2-8,10,12-13,15-16,18H2,1H3,(H,22,23)/b11-9-,17-14+ |
| InChIKey | QZCMHXPXGACWLJ-QWAPPMFBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-oxoEDE (CHEBI:72844) has functional parent 15-HEDE (CHEBI:72847) |
| 15-oxoEDE (CHEBI:72844) has role metabolite (CHEBI:25212) |
| 15-oxoEDE (CHEBI:72844) is a enone (CHEBI:51689) |
| 15-oxoEDE (CHEBI:72844) is a OxoEDE (CHEBI:72846) |
| 15-oxoEDE (CHEBI:72844) is conjugate acid of 15-oxo-EDE(1−) (CHEBI:134546) |
| Incoming Relation(s) |
| 15-oxo-EDE(1−) (CHEBI:134546) is conjugate base of 15-oxoEDE (CHEBI:72844) |
| IUPAC Name |
|---|
| (11Z,13E)-15-oxoicosa-11,13-dienoic acid |
| Synonyms | Source |
|---|---|
| 15-KEDE | ChEBI |
| 15-keto-11Z,13E-eicosadienoic acid | ChEBI |
| 15-oxo-11Z,13E-eicosadienoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01060073 | LIPID MAPS |