EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N2O2 |
| Net Charge | 0 |
| Average Mass | 218.256 |
| Monoisotopic Mass | 218.10553 |
| SMILES | Cn1cc(CC(N)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C12H14N2O2/c1-14-7-8(6-10(13)12(15)16)9-4-2-3-5-11(9)14/h2-5,7,10H,6,13H2,1H3,(H,15,16) |
| InChIKey | ZADWXFSZEAPBJS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.13.11.52 (indoleamine 2,3-dioxygenase) inhibitor An EC 1.13.11.* (oxidoreductase acting on single donors and incorporating 2 atoms of oxygen) inhibitor that interferes with the action of indoleamine 2,3-dioxygenase (EC 1.13.11.52). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methyltryptophan (CHEBI:72821) has role antineoplastic agent (CHEBI:35610) |
| 1-methyltryptophan (CHEBI:72821) has role EC 1.13.11.52 (indoleamine 2,3-dioxygenase) inhibitor (CHEBI:72854) |
| 1-methyltryptophan (CHEBI:72821) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 1-methyltryptophan (CHEBI:72821) is a tryptophan derivative (CHEBI:27164) |
| IUPAC Name |
|---|
| 1-methyltryptophan |
| Synonyms | Source |
|---|---|
| 1-methyl-DL-tryptophan | ChemIDplus |
| N-methyl-DL-tryptophan | ChEBI |
| N-methyltryptophan | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1-Methyltryptophan | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20071 | Reaxys |
| CAS:26988-72-7 | ChemIDplus |
| Citations |
|---|