EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19BrO2 |
| Net Charge | 0 |
| Average Mass | 251.164 |
| Monoisotopic Mass | 250.05684 |
| SMILES | CCCCCCCCC(Br)C(=O)O |
| InChI | InChI=1S/C10H19BrO2/c1-2-3-4-5-6-7-8-9(11)10(12)13/h9H,2-8H2,1H3,(H,12,13) |
| InChIKey | KNLOTZNPRIFUAR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-bromodecanoic acid (CHEBI:72820) is a 2-bromocarboxylic acid (CHEBI:134367) |
| 2-bromodecanoic acid (CHEBI:72820) is a bromo fatty acid (CHEBI:61709) |
| 2-bromodecanoic acid (CHEBI:72820) is a medium-chain fatty acid (CHEBI:59554) |
| 2-bromodecanoic acid (CHEBI:72820) is a straight-chain fatty acid (CHEBI:59202) |
| IUPAC Name |
|---|
| 2-bromodecanoic acid |
| Synonyms | Source |
|---|---|
| 2-bromocapric acid | ChEBI |
| α-bromodecanoic acid | ChEBI |
| α-bromocapric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01090003 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1767667 | Reaxys |
| CAS:2623-95-2 | ChemIDplus |