EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12O2 |
| Net Charge | 0 |
| Average Mass | 140.182 |
| Monoisotopic Mass | 140.08373 |
| SMILES | [H]C(C)=CC([H])=CC(=O)OCC |
| InChI | InChI=1S/C8H12O2/c1-3-5-6-7-8(9)10-4-2/h3,5-7H,4H2,1-2H3 |
| InChIKey | OZZYKXXGCOLLLO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl sorbate (CHEBI:72819) has functional parent sorbic acid (CHEBI:35962) |
| ethyl sorbate (CHEBI:72819) has role metabolite (CHEBI:25212) |
| ethyl sorbate (CHEBI:72819) is a fatty acid ethyl ester (CHEBI:78206) |
| IUPAC Name |
|---|
| ethyl hexa-2,4-dienoate |
| Synonym | Source |
|---|---|
| 2,4-hexadienoic acid, ethyl ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1362941 | Reaxys |