EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O3 |
| Net Charge | 0 |
| Average Mass | 294.435 |
| Monoisotopic Mass | 294.21949 |
| SMILES | CCCCCC(=O)/C=C/C=C/CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O3/c1-2-3-11-14-17(19)15-12-9-7-5-4-6-8-10-13-16-18(20)21/h7,9,12,15H,2-6,8,10-11,13-14,16H2,1H3,(H,20,21)/b9-7+,15-12+ |
| InChIKey | JHXAZBBVQSRKJR-KDFHGORWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Carthamus oxyacantha (ncbitaxon:122010) | aerial part (BTO:0001658) | PubMed (22060189) | Crude ethanolic extract of aerial parts |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-oxo-9E,11E-ODE (CHEBI:72815) has role metabolite (CHEBI:25212) |
| 13-oxo-9E,11E-ODE (CHEBI:72815) is a 13-oxo-9,11-octadecadienoic acid (CHEBI:136531) |
| 13-oxo-9E,11E-ODE (CHEBI:72815) is a oxo fatty acid (CHEBI:59644) |
| IUPAC Name |
|---|
| (9E,11E)-13-oxooctadeca-9,11-dienoic acid |
| Synonym | Source |
|---|---|
| 13-OxoODE | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA02000252 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7688957 | Reaxys |