EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C=C\C(O)CCCC(=O)O |
| InChI | InChI=1S/C20H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(21)17-15-18-20(22)23/h3-4,6-7,9-10,12-14,16,19,21H,2,5,8,11,15,17-18H2,1H3,(H,22,23)/b4-3-,7-6-,10-9-,13-12-,16-14+ |
| InChIKey | FTAGQROYQYQRHF-FCWZHQICSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS143) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-HEPE (CHEBI:72801) has role mouse metabolite (CHEBI:75771) |
| 5-HEPE (CHEBI:72801) is a HEPE (CHEBI:72799) |
| 5-HEPE (CHEBI:72801) is conjugate acid of 5-HEPE(1−) (CHEBI:90737) |
| Incoming Relation(s) |
| 5-HEPE(1−) (CHEBI:90737) is conjugate base of 5-HEPE (CHEBI:72801) |
| IUPAC Name |
|---|
| (6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoic acid |
| Synonyms | Source |
|---|---|
| (±)-5-hydroxy-6E,8Z,11Z,14Z,17Z-eicosapentaenoic acid | LIPID MAPS |
| (±)-5-HEPE | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA03070027 | LIPID MAPS |
| HMDB0005081 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8641363 | Reaxys |
| CAS:83952-40-3 | ChemIDplus |