EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H23NO11S |
| Net Charge | 0 |
| Average Mass | 593.566 |
| Monoisotopic Mass | 593.09918 |
| SMILES | COc1ccc(-c2c3c4cc(OC)c(OS(=O)(=O)O)cc4oc(=O)c3n3ccc4cc(OC)c(OC)cc4c23)cc1O |
| InChI | InChI=1S/C29H23NO11S/c1-36-19-6-5-15(9-18(19)31)25-26-17-12-23(39-4)24(41-42(33,34)35)13-20(17)40-29(32)28(26)30-8-7-14-10-21(37-2)22(38-3)11-16(14)27(25)30/h5-13,31H,1-4H3,(H,33,34,35) |
| InChIKey | JMOHRMCZYHDLSW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lamellarin α 20-hydrogen sulfate (CHEBI:72792) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| lamellarin α 20-hydrogen sulfate (CHEBI:72792) is a alkaloid (CHEBI:22315) |
| lamellarin α 20-hydrogen sulfate (CHEBI:72792) is a guaiacols (CHEBI:134251) |
| lamellarin α 20-hydrogen sulfate (CHEBI:72792) is a heterocyclyl sulfate (CHEBI:37839) |
| lamellarin α 20-hydrogen sulfate (CHEBI:72792) is a δ-lactone (CHEBI:18946) |
| lamellarin α 20-hydrogen sulfate (CHEBI:72792) is conjugate acid of lamellarin α 20-sulfate(1−) (CHEBI:72791) |
| Incoming Relation(s) |
| lamellarin α 20-sulfate(1−) (CHEBI:72791) is conjugate base of lamellarin α 20-hydrogen sulfate (CHEBI:72792) |
| IUPAC Name |
|---|
| 14-(3-hydroxy-4-methoxyphenyl)-2,11,12-trimethoxy-6-oxo-6H-chromeno[4',3':4,5]pyrrolo[2,1-a]isoquinolin-3-yl hydrogen sulfate |