EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H40N6O16P |
| Net Charge | -3 |
| Average Mass | 771.650 |
| Monoisotopic Mass | 771.22549 |
| SMILES | C[C@@H]1Nc2nc(N)nc(=O)c2N=C1[C@@H](C)Nc1ccc(C[C@H](O)[C@H](O)[C@H](O)CO[C@H]2O[C@H](COP(=O)([O-])O[C@@H](CCC(=O)[O-])C(=O)[O-])[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C30H43N6O16P/c1-12(21-13(2)33-26-22(34-21)27(44)36-30(31)35-26)32-15-5-3-14(4-6-15)9-16(37)23(41)17(38)10-49-29-25(43)24(42)19(51-29)11-50-53(47,48)52-18(28(45)46)7-8-20(39)40/h3-6,12-13,16-19,23-25,29,32,37-38,41-43H,7-11H2,1-2H3,(H,39,40)(H,45,46)(H,47,48)(H4,31,33,35,36,44)/p-3/t12-,13+,16+,17-,18+,19-,23+,24-,25-,29+/m1/s1 |
| InChIKey | WTMBWYHMZCVPRJ-WJBIZLLUSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,8-dihydromethanopterin(3−) (CHEBI:72788) is a carboxylic acid trianion (CHEBI:38717) |
| 7,8-dihydromethanopterin(3−) (CHEBI:72788) is a organophosphate oxoanion (CHEBI:58945) |
| 7,8-dihydromethanopterin(3−) (CHEBI:72788) is conjugate base of 7,8-dihydromethanopterin (CHEBI:2251) |
| Incoming Relation(s) |
| 7,8-dihydromethanopterin (CHEBI:2251) is conjugate acid of 7,8-dihydromethanopterin(3−) (CHEBI:72788) |
| IUPAC Name |
|---|
| 1-[4-({(1R)-1-[(7S)-2-amino-7-methyl-4-oxo-3,4,7,8-tetrahydropteridin-6-yl]ethyl}amino)phenyl]-1-deoxy-5-O-(5-O-{[(1S)-1,3-dicarboxylatopropoxy]phosphinato}-α-D-ribofuranosyl)-D-ribitol |
| Synonyms | Source |
|---|---|
| DHMPT(3−) | ChEBI |
| dihydromethanopterin(3−) | ChEBI |
| H2MPT(3−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 7,8-dihydromethanopterin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-10789 | MetaCyc |
| Citations |
|---|