EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:72787 - 4-(β-D-ribofuranosyl)aminobenzene 5'-phosphate
| Formula | C11H16NO7P |
| Net Charge | 0 |
| Average Mass | 305.223 |
| Monoisotopic Mass | 305.06644 |
| SMILES | Nc1ccc([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C11H16NO7P/c12-7-3-1-6(2-4-7)11-10(14)9(13)8(19-11)5-18-20(15,16)17/h1-4,8-11,13-14H,5,12H2,(H2,15,16,17)/t8-,9-,10-,11+/m1/s1 |
| InChIKey | UKBUHWIOGWAJEO-DBIOUOCHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(β-D-ribofuranosyl)aminobenzene 5'-phosphate (CHEBI:72787) is a C-glycosyl compound (CHEBI:20857) |
| 4-(β-D-ribofuranosyl)aminobenzene 5'-phosphate (CHEBI:72787) is a ribose monophosphate (CHEBI:35159) |
| 4-(β-D-ribofuranosyl)aminobenzene 5'-phosphate (CHEBI:72787) is a substituted aniline (CHEBI:48975) |
| 4-(β-D-ribofuranosyl)aminobenzene 5'-phosphate (CHEBI:72787) is conjugate acid of 4-(β-D-ribofuranosyl)aminobenzene 5'-phosphate(2−) (CHEBI:72778) |
| Incoming Relation(s) |
| 4-(β-D-ribofuranosyl)aminobenzene 5'-phosphate(2−) (CHEBI:72778) is conjugate base of 4-(β-D-ribofuranosyl)aminobenzene 5'-phosphate (CHEBI:72787) |
| IUPAC Name |
|---|
| (1S)-1-(4-aminophenyl)-1,4-anhydro-5-O-phosphono-D-ribitol |
| Synonyms | Source |
|---|---|
| 4-aminophenyl β-D-ribofuranoside 5-phosphate | ChEBI |
| 4-(5-O-phospho-β-D-ribofuranosyl)aniline | ChEBI |
| 4-(5-O-phospho-β-D-ribofuranosyl)aminobenzene | ChEBI |
| 4-(β-D-ribofuranosyl)aniline 5'-phosphate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-7652 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22529182 | Reaxys |
| Citations |
|---|