EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O3 |
| Net Charge | 0 |
| Average Mass | 320.473 |
| Monoisotopic Mass | 320.23514 |
| SMILES | CCCCC/C=C\C/C=C\CC(O)/C=C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O3/c1-2-3-4-5-6-7-8-10-13-16-19(21)17-14-11-9-12-15-18-20(22)23/h6-7,9-11,13-14,17,19,21H,2-5,8,12,15-16,18H2,1H3,(H,22,23)/b7-6-,11-9-,13-10-,17-14+ |
| InChIKey | KATOYYZUTNAWSA-OIZRIKEUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-HETE (CHEBI:72786) has role metabolite (CHEBI:25212) |
| 9-HETE (CHEBI:72786) is a HETE (CHEBI:36275) |
| 9-HETE (CHEBI:72786) is conjugate acid of 9-HETE(1−) (CHEBI:133850) |
| Incoming Relation(s) |
| 9-HETE(1−) (CHEBI:133850) is conjugate base of 9-HETE (CHEBI:72786) |
| IUPAC Name |
|---|
| (5Z,7E,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 9-hydroxy-5Z,7E,11Z,14Z-eicosatetraenoic acid | LIPID MAPS |
| 9-hydroxy-(5Z,7E,11Z,14Z)-icosatetraenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA03060089 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4476711 | Reaxys |