EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18O8 |
| Net Charge | 0 |
| Average Mass | 278.257 |
| Monoisotopic Mass | 278.10017 |
| SMILES | C=C(CCO)C(=O)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H18O8/c1-5(2-3-12)10(16)18-4-6-7(13)8(14)9(15)11(17)19-6/h6-9,11-15,17H,1-4H2/t6-,7-,8+,9-,11?/m1/s1 |
| InChIKey | NABVFHUVYXEKSQ-OGADHKOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-tuliposide A (CHEBI:72781) has functional parent D-glucopyranose (CHEBI:4167) |
| 6-tuliposide A (CHEBI:72781) has role allergen (CHEBI:50904) |
| 6-tuliposide A (CHEBI:72781) has role metabolite (CHEBI:25212) |
| 6-tuliposide A (CHEBI:72781) is a 6-O-acyl-D-glucose (CHEBI:59475) |
| 6-tuliposide A (CHEBI:72781) is a homoallylic alcohol (CHEBI:134362) |
| IUPAC Name |
|---|
| 6-O-(4-hydroxy-2-methylenebutanoyl)-D-glucopyranose |
| UniProt Name | Source |
|---|---|
| 6-tuliposide A | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-15227 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5753001 | Reaxys |
| Citations |
|---|