EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O2 |
| Net Charge | 0 |
| Average Mass | 136.150 |
| Monoisotopic Mass | 136.05243 |
| SMILES | COC(=O)c1ccccc1 |
| InChI | InChI=1S/C8H8O2/c1-10-8(9)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | QPJVMBTYPHYUOC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | insect attractant A chemical that attracts insects. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl benzoate (CHEBI:72775) has role insect attractant (CHEBI:24850) |
| methyl benzoate (CHEBI:72775) has role metabolite (CHEBI:25212) |
| methyl benzoate (CHEBI:72775) is a benzoate ester (CHEBI:36054) |
| methyl benzoate (CHEBI:72775) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| methyl benzoate |
| Synonyms | Source |
|---|---|
| Benzoic acid, methyl ester | ChemIDplus |
| Methyl benzenecarboxylate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| methyl benzoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-6441 | MetaCyc |
| HMDB0033968 | HMDB |
| Methyl_benzoate | Wikipedia |
| Citations |
|---|