EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34N4O11 |
| Net Charge | 0 |
| Average Mass | 482.487 |
| Monoisotopic Mass | 482.22241 |
| SMILES | NC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H](N)C[C@@H]2N)C(=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H34N4O11/c19-2-6-10(25)12(27)13(28)18(30-6)33-16-5(21)1-4(20)15(14(16)29)32-17-11(26)8(22)9(24)7(3-23)31-17/h4-12,14-18,23-27,29H,1-3,19-22H2/t4-,5+,6-,7-,8+,9-,10-,11-,12+,14-,15+,16-,17-,18-/m1/s1 |
| InChIKey | FQALWUBUOWECTR-WSWRBCCJSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-oxokanamycin (CHEBI:72769) has functional parent kanamycin A (CHEBI:17630) |
| 2'-oxokanamycin (CHEBI:72769) is a kanamycins (CHEBI:24951) |
| 2'-oxokanamycin (CHEBI:72769) is conjugate base of 2'-oxokanamycin(4+) (CHEBI:72757) |
| Incoming Relation(s) |
| 2'-oxokanamycin(4+) (CHEBI:72757) is conjugate acid of 2'-oxokanamycin (CHEBI:72769) |
| IUPAC Name |
|---|
| (1S,2R,3R,4S,6R)-4,6-diamino-3-[(6-amino-6-deoxy-α-D-arabino-hexopyranosyl-2-ulose)oxy]-2-hydroxycyclohexyl 3-amino-3-deoxy-α-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 2'-dehydrokanamycin A | ChEBI |
| 2'-ketokanamycin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22604553 | Reaxys |
| Citations |
|---|