EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23N3O2 |
| Net Charge | 0 |
| Average Mass | 349.434 |
| Monoisotopic Mass | 349.17903 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@]1([H])Cc3c(nc4ccccc34)[C@H](C=C(C)C)N1C2=O |
| InChI | InChI=1S/C21H23N3O2/c1-12(2)10-17-19-14(13-6-3-4-7-15(13)22-19)11-18-20(25)23-9-5-8-16(23)21(26)24(17)18/h3-4,6-7,10,16-18,22H,5,8-9,11H2,1-2H3/t16-,17-,18-/m0/s1 |
| InChIKey | LQXCSIKDOISJTI-BZSNNMDCSA-N |
| Roles Classification |
|---|
| Biological Roles: | mycotoxin Poisonous substance produced by fungi. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| demethoxyfumitremorgin C (CHEBI:72767) has role mycotoxin (CHEBI:25442) |
| demethoxyfumitremorgin C (CHEBI:72767) is a indole alkaloid (CHEBI:38958) |
| demethoxyfumitremorgin C (CHEBI:72767) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (5aS,12S,14aS)-12-(2-methylprop-1-en-1-yl)-1,2,3,5a,6,11,12,14a-octahydro-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione |
| UniProt Name | Source |
|---|---|
| demethoxyfumitremorgin C | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029565 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4719119 | Reaxys |
| Citations |
|---|