EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25N3O5 |
| Net Charge | 0 |
| Average Mass | 411.458 |
| Monoisotopic Mass | 411.17942 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@]1(O)[C@@H](O)c3c(nc4cc(OC)ccc34)[C@H](C=C(C)C)N1C2=O |
| InChI | InChI=1S/C22H25N3O5/c1-11(2)9-16-18-17(13-7-6-12(30-3)10-14(13)23-18)19(26)22(29)21(28)24-8-4-5-15(24)20(27)25(16)22/h6-7,9-10,15-16,19,23,26,29H,4-5,8H2,1-3H3/t15-,16-,19-,22+/m0/s1 |
| InChIKey | CPHRCQUGNAGVIB-FWJAZRMLSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12,13-dihydroxyfumitremorgin C (CHEBI:72764) has functional parent fumitremorgin C (CHEBI:72763) |
| 12,13-dihydroxyfumitremorgin C (CHEBI:72764) is a aromatic ether (CHEBI:35618) |
| 12,13-dihydroxyfumitremorgin C (CHEBI:72764) is a diol (CHEBI:23824) |
| 12,13-dihydroxyfumitremorgin C (CHEBI:72764) is a indole alkaloid (CHEBI:38958) |
| 12,13-dihydroxyfumitremorgin C (CHEBI:72764) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (5aR,6S,12S,14aS)-5a,6-dihydroxy-9-methoxy-12-(2-methylprop-1-en-1-yl)-1,2,3,5a,6,11,12,14a-octahydro-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione |
| Synonym | Source |
|---|---|
| 12α,13α-dihydroxyfumitremorgin C | ChEBI |
| UniProt Name | Source |
|---|---|
| 12α,13α-dihydroxyfumitremorgin C | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0038581 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4727408 | Reaxys |
| CAS:111427-99-7 | HMDB |
| Citations |
|---|