EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:72749 - lysophosphatidylethanolamine (0:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z))
| Formula | C27H44NO7P |
| Net Charge | 0 |
| Average Mass | 525.623 |
| Monoisotopic Mass | 525.28554 |
| SMILES | [H][C@@](CO)(COP(=O)(O)OCCN)OC(=O)CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C27H44NO7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-27(30)35-26(24-29)25-34-36(31,32)33-23-22-28/h3-4,6-7,9-10,12-13,15-16,18-19,26,29H,2,5,8,11,14,17,20-25,28H2,1H3,(H,31,32)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18-/t26-/m1/s1 |
| InChIKey | TWBVHOYVCUOMJY-PAUXXPOVSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lysophosphatidylethanolamine (0:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) (CHEBI:72749) has functional parent all-cis-docosa-4,7,10,13,16,19-hexaenoic acid (CHEBI:28125) |
| lysophosphatidylethanolamine (0:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) (CHEBI:72749) has role metabolite (CHEBI:25212) |
| lysophosphatidylethanolamine (0:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) (CHEBI:72749) is a 2-acyl-sn-glycero-3-phosphoethanolamine (CHEBI:28936) |
| lysophosphatidylethanolamine (0:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) (CHEBI:72749) is a lysophosphatidylethanolamine 22:6 (CHEBI:72734) |
| IUPAC Name |
|---|
| (2R)-1-{[(2-aminoethoxy)(hydroxy)phosphoryl]oxy}-3-hydroxypropan-2-yl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| Synonyms | Source |
|---|---|
| PE 0:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z) | ChEBI |
| LPE(0:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) | ChEBI |
| LysoPE(0:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) | ChEBI |
| Lyso-PE(0:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) | ChEBI |
| PE(0:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) | ChEBI |
| LPE 0:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011496 | HMDB |
| Citations |
|---|