EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H44NO7P |
| Net Charge | 0 |
| Average Mass | 501.601 |
| Monoisotopic Mass | 501.28554 |
| SMILES | [H][C@@](O)(COC(=O)CCCCCC/C=C\C/C=C\C/C=C\C/C=C\CC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C25H44NO7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(28)31-22-24(27)23-33-34(29,30)32-21-20-26/h3-4,6-7,9-10,12-13,24,27H,2,5,8,11,14-23,26H2,1H3,(H,29,30)/b4-3-,7-6-,10-9-,13-12-/t24-/m1/s1 |
| InChIKey | JPNPIRVRGLGTRE-YSKCIPFOSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lysophosphatidylethanolamine (20:4(8Z,11Z,14Z,17Z)/0:0) (CHEBI:72742) has functional parent all-cis-8,11,14,17-icosatetraenoic acid (CHEBI:71488) |
| lysophosphatidylethanolamine (20:4(8Z,11Z,14Z,17Z)/0:0) (CHEBI:72742) has role metabolite (CHEBI:25212) |
| lysophosphatidylethanolamine (20:4(8Z,11Z,14Z,17Z)/0:0) (CHEBI:72742) is a 1-acyl-sn-glycero-3-phosphoethanolamine (CHEBI:29017) |
| lysophosphatidylethanolamine (20:4(8Z,11Z,14Z,17Z)/0:0) (CHEBI:72742) is a lysophosphatidylethanolamine 20:4 (CHEBI:64569) |
| IUPAC Name |
|---|
| (2R)-3-{[(2-aminoethoxy)(hydroxy)phosphoryl]oxy}-2-hydroxypropyl (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate |
| Synonyms | Source |
|---|---|
| LPE(20:4(8Z,11Z,14Z,17Z)/0:0) | ChEBI |
| PE 20:4(8Z,11Z,14Z,17Z)/0:0 | ChEBI |
| LPE 20:4(8Z,11Z,14Z,17Z)/0:0 | ChEBI |
| Lyso-PE(20:4(8Z,11Z,14Z,17Z)/0:0) | ChEBI |
| LysoPE(20:4(8Z,11Z,14Z,17Z)/0:0) | ChEBI |
| PE(20:4(8Z,11Z,14Z,17Z)/0:0) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011518 | HMDB |
| Citations |
|---|