EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H44NO7P |
| Net Charge | 0 |
| Average Mass | 501.601 |
| Monoisotopic Mass | 501.28554 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O[C@H](CO)COP(=O)(O)OCCN |
| InChI | InChI=1S/C25H44NO7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(28)33-24(22-27)23-32-34(29,30)31-21-20-26/h6-7,9-10,12-13,15-16,24,27H,2-5,8,11,14,17-23,26H2,1H3,(H,29,30)/b7-6-,10-9-,13-12-,16-15-/t24-/m1/s1 |
| InChIKey | YWOCITMXHHTBAW-XSQXPFHXSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-arachidonyl-sn-glycero-3-phosphoethanolamine (CHEBI:72741) has functional parent arachidonic acid (CHEBI:15843) |
| 2-arachidonyl-sn-glycero-3-phosphoethanolamine (CHEBI:72741) has role metabolite (CHEBI:25212) |
| 2-arachidonyl-sn-glycero-3-phosphoethanolamine (CHEBI:72741) is a 2-acyl-sn-glycero-3-phosphoethanolamine (CHEBI:28936) |
| 2-arachidonyl-sn-glycero-3-phosphoethanolamine (CHEBI:72741) is a lysophosphatidylethanolamine 20:4 (CHEBI:64569) |
| 2-arachidonyl-sn-glycero-3-phosphoethanolamine (CHEBI:72741) is tautomer of 2-arachidonoyl-sn-glycero-3-phosphoethanolamine zwitterion (CHEBI:76091) |
| Incoming Relation(s) |
| 2-arachidonoyl-sn-glycero-3-phosphoethanolamine zwitterion (CHEBI:76091) is tautomer of 2-arachidonyl-sn-glycero-3-phosphoethanolamine (CHEBI:72741) |
| IUPAC Name |
|---|
| (2R)-1-{[(2-aminoethoxy)(hydroxy)phosphoryl]oxy}-3-hydroxypropan-2-yl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| Synonyms | Source |
|---|---|
| LPE 0:0/20:4(5Z,8Z,11Z,14Z) | ChEBI |
| Lyso-PE(0:0/20:4(5Z,8Z,11Z,14Z)) | ChEBI |
| LPE(0:0/20:4(5Z,8Z,11Z,14Z)) | ChEBI |
| LysoPE(0:0/20:4(5Z,8Z,11Z,14Z)) | ChEBI |
| PE 0:0/20:4(5Z,8Z,11Z,14Z) | ChEBI |
| PE(0:0/20:4(5Z,8Z,11Z,14Z)) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011487 | HMDB |