EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N2O4 |
| Net Charge | 0 |
| Average Mass | 174.156 |
| Monoisotopic Mass | 174.06406 |
| SMILES | [H]C(=N)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H10N2O4/c7-3-8-4(6(11)12)1-2-5(9)10/h3-4H,1-2H2,(H2,7,8)(H,9,10)(H,11,12)/t4-/m0/s1 |
| InChIKey | NRXIKWMTVXPVEF-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formimidoyl-L-glutamic acid (CHEBI:7274) is a L-glutamic acid derivative (CHEBI:83982) |
| N-formimidoyl-L-glutamic acid (CHEBI:7274) is a dicarboxylic acid (CHEBI:35692) |
| N-formimidoyl-L-glutamic acid (CHEBI:7274) is conjugate acid of N-formimidoyl-L-glutamate(1−) (CHEBI:58928) |
| N-formimidoyl-L-glutamic acid (CHEBI:7274) is conjugate acid of N-formimidoyl-L-glutamate(2−) (CHEBI:18327) |
| Incoming Relation(s) |
| N-formimidoyl-L-glutamate(1−) (CHEBI:58928) is conjugate base of N-formimidoyl-L-glutamic acid (CHEBI:7274) |
| N-formimidoyl-L-glutamate(2−) (CHEBI:18327) is conjugate base of N-formimidoyl-L-glutamic acid (CHEBI:7274) |
| IUPAC Names |
|---|
| (2S)-2-(methanimidamido)pentanedioic acid |
| N-methanimidoyl-L-glutamic acid |
| Synonyms | Source |
|---|---|
| N-Formimino-L-glutamate | KEGG COMPOUND |
| N-Formimidoyl-L-glutamate | KEGG COMPOUND |