EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H40O4 |
| Net Charge | 0 |
| Average Mass | 392.580 |
| Monoisotopic Mass | 392.29266 |
| SMILES | [H][C@@]12C[C@@H](O)[C@]3([H])C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCC(=O)O |
| InChI | InChI=1S/C24H40O4/c1-14(4-7-22(27)28)17-5-6-18-16-13-21(26)20-12-15(25)8-10-24(20,3)19(16)9-11-23(17,18)2/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15+,16+,17-,18+,19+,20+,21-,23-,24-/m1/s1 |
| InChIKey | DGABKXLVXPYZII-UNSLZIRMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β,6β-dihydroxy-5β-cholan-24-oic acid (CHEBI:72724) has role metabolite (CHEBI:25212) |
| 3β,6β-dihydroxy-5β-cholan-24-oic acid (CHEBI:72724) is a 3β-hydroxy steroid (CHEBI:36836) |
| 3β,6β-dihydroxy-5β-cholan-24-oic acid (CHEBI:72724) is a 6β-hydroxy steroid (CHEBI:36851) |
| 3β,6β-dihydroxy-5β-cholan-24-oic acid (CHEBI:72724) is a bile acid (CHEBI:3098) |
| 3β,6β-dihydroxy-5β-cholan-24-oic acid (CHEBI:72724) is a dihydroxy-5β-cholanic acid (CHEBI:23775) |
| Manual Xrefs | Databases |
|---|---|
| LMST04010027 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3218393 | Reaxys |
| Citations |
|---|