EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9O7 |
| Net Charge | -3 |
| Average Mass | 217.153 |
| Monoisotopic Mass | 217.03647 |
| SMILES | O=C([O-])CCC[C@H](C(=O)[O-])[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C8H12O7/c9-5(10)3-1-2-4(7(12)13)6(11)8(14)15/h4,6,11H,1-3H2,(H,9,10)(H,12,13)(H,14,15)/p-3/t4-,6+/m0/s1 |
| InChIKey | KVEBLTAWTCBJNF-UJURSFKZSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-threo-isodihomocitrate(3−) (CHEBI:72722) is a tricarboxylic acid trianion (CHEBI:27092) |
| (−)-threo-isodihomocitrate(3−) (CHEBI:72722) is conjugate base of (−)-threo-isodihomocitric acid (CHEBI:72713) |
| Incoming Relation(s) |
| (−)-threo-isodihomocitric acid (CHEBI:72713) is conjugate acid of (−)-threo-isodihomocitrate(3−) (CHEBI:72722) |
| IUPAC Name |
|---|
| (1R,2S)-1-hydroxypentane-1,2,5-tricarboxylate |
| Synonyms | Source |
|---|---|
| (1R,2S)-1-hydroxypentane-1,2,5-tricarboxylate(3−) | SUBMITTER |
| (2R,3S)-isodihomocitrate | ChEBI |
| (2R,3S)-iso(homo)2citrate | ChEBI |
| (−)-threo-1-hydroxy-1,2,5-pentane-tricarboxylate(3−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (2R,3S)-iso(homo)2citrate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-285 | MetaCyc |