EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H36N4O6 |
| Net Charge | 0 |
| Average Mass | 584.673 |
| Monoisotopic Mass | 584.26348 |
| SMILES | C=CC1=C(C)/C(=C\c2nc(Cc3nc(/C=C4\NC(=O)C(C)=C4C=C)c(C)c3CCC(=O)O)c(CCC(=O)O)c2C)NC1=O |
| InChI | InChI=1S/C33H36N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h7-8,13-14,34-35H,1-2,9-12,15H2,3-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/b26-13+,27-14- |
| InChIKey | BPYKTIZUTYGOLE-KDUUSRDASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4E,15Z-bilirubin IXa (CHEBI:72719) has role metabolite (CHEBI:25212) |
| 4E,15Z-bilirubin IXa (CHEBI:72719) is a biladienes (CHEBI:36735) |
| 4E,15Z-bilirubin IXa (CHEBI:72719) is a dicarboxylic acid (CHEBI:35692) |
| Synonym | Source |
|---|---|
| (4E)2,17-diethenyl-1,10,19,22,23,24-hexahydro-3,7,13,18-tetramethyl-1,19-dioxo--21H-Biline-8,12-dipropanoic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000488 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1236110 | Reaxys |
| Citations |
|---|