EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O6 |
| Net Charge | 0 |
| Average Mass | 202.162 |
| Monoisotopic Mass | 202.04774 |
| SMILES | O=C(O)/C=C(/CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H10O6/c9-6(10)3-1-2-5(8(13)14)4-7(11)12/h4H,1-3H2,(H,9,10)(H,11,12)(H,13,14)/b5-4- |
| InChIKey | WXZASCSXAMHFCX-PLNGDYQASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-dihomoaconitic acid (CHEBI:72708) is a tricarboxylic acid (CHEBI:27093) |
| cis-dihomoaconitic acid (CHEBI:72708) is conjugate acid of cis-dihomoaconitate(3−) (CHEBI:72710) |
| Incoming Relation(s) |
| cis-dihomoaconitate(3−) (CHEBI:72710) is conjugate base of cis-dihomoaconitic acid (CHEBI:72708) |
| IUPAC Name |
|---|
| (1Z)-pent-1-ene-1,2,5-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| (Z)-1,2,5-pent-1-enetricarboxylic acid | SUBMITTER |
| (Z)-dihomoaconitic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-153 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21144463 | Reaxys |