EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O5 |
| Net Charge | 0 |
| Average Mass | 174.152 |
| Monoisotopic Mass | 174.05282 |
| SMILES | O=C(O)CCCCC(=O)C(=O)O |
| InChI | InChI=1S/C7H10O5/c8-5(7(11)12)3-1-2-4-6(9)10/h1-4H2,(H,9,10)(H,11,12) |
| InChIKey | HABHUTWTLGRDDU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxopimelic acid (CHEBI:72700) has functional parent pimelic acid (CHEBI:30531) |
| 2-oxopimelic acid (CHEBI:72700) is a oxo dicarboxylic acid (CHEBI:36145) |
| 2-oxopimelic acid (CHEBI:72700) is conjugate acid of 2-oxopimelate(2−) (CHEBI:72701) |
| Incoming Relation(s) |
| 2-oxopimelate(2−) (CHEBI:72701) is conjugate base of 2-oxopimelic acid (CHEBI:72700) |
| IUPAC Name |
|---|
| 2-oxoheptanedionic acid |
| Synonyms | Source |
|---|---|
| 2-ketoheptanedionic acid | ChEBI |
| 2-ketopimelic acid | ChEBI |
| 2-Oxoheptanedionic acid | KEGG COMPOUND |
| alpha-Ketopimelate | KEGG COMPOUND |
| α-ketoheptanedionic acid | ChEBI |
| α-ketopimelic acid | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1773648 | Reaxys |
| CAS:17126-90-8 | ChemIDplus |
| Citations |
|---|