EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12O7 |
| Net Charge | 0 |
| Average Mass | 220.177 |
| Monoisotopic Mass | 220.05830 |
| SMILES | O=C(O)CCC[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H12O7/c9-5(10)2-1-3-8(15,7(13)14)4-6(11)12/h15H,1-4H2,(H,9,10)(H,11,12)(H,13,14)/t8-/m1/s1 |
| InChIKey | LOUWLTSPEXZLSA-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-dihomocitric acid (CHEBI:72694) is a tertiary alcohol (CHEBI:26878) |
| (2R)-dihomocitric acid (CHEBI:72694) is a tricarboxylic acid (CHEBI:27093) |
| (2R)-dihomocitric acid (CHEBI:72694) is conjugate acid of (2R)-dihomocitrate(3−) (CHEBI:72697) |
| Incoming Relation(s) |
| (2R)-dihomocitrate(3−) (CHEBI:72697) is conjugate base of (2R)-dihomocitric acid (CHEBI:72694) |
| IUPAC Name |
|---|
| (2R)-2-hydroxypentane-1,2,5-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| (2R)-2-oxidanylpentane-1,2,5-tricarboxylic acid | ChEBI |
| (R)-2-hydroxy-1,2,5-pentanetricarboxylic acid | KEGG COMPOUND |
| (R)-(Homo)2-citrate | KEGG COMPOUND |