EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H47NO4 |
| Net Charge | 0 |
| Average Mass | 425.654 |
| Monoisotopic Mass | 425.35051 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C25H47NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25(29)30-23(21-24(27)28)22-26(2,3)4/h12-13,23H,5-11,14-22H2,1-4H3/b13-12- |
| InChIKey | IPOLTUVFXFHAHI-SEYXRHQNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (23078175) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-oleoylcarnitine (CHEBI:72689) has role human metabolite (CHEBI:77746) |
| O-oleoylcarnitine (CHEBI:72689) is a O-octadecenoylcarnitine (CHEBI:86475) |
| IUPAC Name |
|---|
| 3-[(9Z)-octadec-9-enoyloxy]-4-(trimethylazaniumyl)butanoate |
| Synonyms | Source |
|---|---|
| 3-[(9Z)-octadec-9-enoyloxy]-4-(trimethylammonio)butanoate | IUPAC |
| (9Z)-octadec-9-enoylcarnitine | ChEBI |
| acylcarnitine C18:1 | ChEBI |
| cis-9-octadecenoylcarnitine | ChEBI |
| oleoylcarnitine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0005065 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23110795 | Reaxys |
| CAS:13962-05-5 | ChemIDplus |
| Citations |
|---|