EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O5 |
| Net Charge | 0 |
| Average Mass | 270.285 |
| Monoisotopic Mass | 270.12157 |
| SMILES | C[C@H](N)C(=O)N[C@@H](C[C@@H]1CCC(=O)[C@@H]2O[C@H]12)C(=O)O |
| InChI | InChI=1S/C12H18N2O5/c1-5(13)11(16)14-7(12(17)18)4-6-2-3-8(15)10-9(6)19-10/h5-7,9-10H,2-4,13H2,1H3,(H,14,16)(H,17,18)/t5-,6-,7-,9+,10-/m0/s1 |
| InChIKey | XFOUAXMJRHNTOP-PFQXTLEHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bacilysin (CHEBI:72687) has role metabolite (CHEBI:25212) |
| bacilysin (CHEBI:72687) is a alicyclic ketone (CHEBI:36132) |
| bacilysin (CHEBI:72687) is a dipeptide (CHEBI:46761) |
| bacilysin (CHEBI:72687) is a epoxide (CHEBI:32955) |
| bacilysin (CHEBI:72687) is a peptide antibiotic (CHEBI:25903) |
| bacilysin (CHEBI:72687) is tautomer of bacilysin zwitterion (CHEBI:84311) |
| Incoming Relation(s) |
| bacilysin zwitterion (CHEBI:84311) is tautomer of bacilysin (CHEBI:72687) |
| IUPAC Name |
|---|
| L-alanyl-3-[(1R,2S,6R)-5-oxo-7-oxabicyclo[4.1.0]hept-2-yl]-L-alanine |
| Synonyms | Source |
|---|---|
| Antibiotic KM 208 | ChemIDplus |
| N-L-Alanyl-3-(5-oxo-7-oxabicyclo(4.1.0)hept-2-yl)-L-alanine | ChemIDplus |
| Tetaine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| EP2179652 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6637452 | Reaxys |
| CAS:29393-20-2 | ChemIDplus |
| Citations |
|---|