EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14O8 |
| Net Charge | 0 |
| Average Mass | 358.302 |
| Monoisotopic Mass | 358.06887 |
| SMILES | O=C1c2cc(O)cc(O)c2C(=O)c2c1cc1c(c2O)[C@H](CCO)[C@@H](O)O1 |
| InChI | InChI=1S/C18H14O8/c19-2-1-7-13-11(26-18(7)25)5-9-14(17(13)24)16(23)12-8(15(9)22)3-6(20)4-10(12)21/h3-5,7,18-21,24-25H,1-2H2/t7-,18-/m0/s1 |
| InChIKey | CMMJVRKBQZHKPV-VIIUKITBSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S-3S)-versiconal hemiacetal (CHEBI:72672) is a versiconal hemiacetal (CHEBI:71638) |
| (2S-3S)-versiconal hemiacetal (CHEBI:72672) is conjugate acid of (2S-3S)-versiconal hemiacetal(1−) (CHEBI:77950) |
| Incoming Relation(s) |
| (2S-3S)-versiconal hemiacetal(1−) (CHEBI:77950) is conjugate base of (2S-3S)-versiconal hemiacetal (CHEBI:72672) |
| IUPAC Name |
|---|
| (2S-3S)-2,4,6,8-tetrahydroxy-3-(2-hydroxyethyl)-2,3-dihydroanthra[2,3-b]furan-5,10-dione |