EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O5 |
| Net Charge | 0 |
| Average Mass | 288.299 |
| Monoisotopic Mass | 288.09977 |
| SMILES | COc1ccc([C@@H]2COc3cc(O)ccc3[C@@H]2O)c(O)c1 |
| InChI | InChI=1S/C16H16O5/c1-20-10-3-5-11(14(18)7-10)13-8-21-15-6-9(17)2-4-12(15)16(13)19/h2-7,13,16-19H,8H2,1H3/t13-,16-/m0/s1 |
| InChIKey | YZBBUYKPTHDZHF-BBRMVZONSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,4R)-7,2'-dihydroxy-4'-methoxyisoflavanol (CHEBI:72646) is a (3R,4R)-4,2'-dihydroxyisoflavans (CHEBI:140181) |
| (3R,4R)-7,2'-dihydroxy-4'-methoxyisoflavanol (CHEBI:72646) is a (3R)-7,2'-dihydroxy-4'-methoxyisoflavanol (CHEBI:71335) |
| IUPAC Name |
|---|
| (3R,4R)-3-(2-hydroxy-4-methoxyphenyl)chromane-4,7-diol |
| UniProt Name | Source |
|---|---|
| (3R,4R)-7,2'-dihydroxy-4'-methoxyisoflavanol | UniProt |