EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10O3 |
| Net Charge | 0 |
| Average Mass | 214.220 |
| Monoisotopic Mass | 214.06299 |
| SMILES | O=C(O)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C13H10O3/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10/h1-9H,(H,14,15) |
| InChIKey | PKRSYEPBQPFNRB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-phenoxybenzoic acid (CHEBI:72636) is a phenoxybenzoic acid (CHEBI:72633) |
| IUPAC Name |
|---|
| 2-phenoxybenzoic acid |
| Synonyms | Source |
|---|---|
| o-carboxydiphenyl ether | ChEBI |
| 2-carboxydiphenyl ether | ChEBI |
| o-phenoxybenzoic aci | ChEBI |
| ortho-phenoxybenzoic acid | NIST Chemistry WebBook |
| 2-PhOC6H4CO2H | ChEBI |
| 2-PhOC6H4COOH | ChEBI |
| Citations |
|---|