EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10O3 |
| Net Charge | 0 |
| Average Mass | 214.220 |
| Monoisotopic Mass | 214.06299 |
| SMILES | O=C(O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C13H10O3/c14-13(15)10-5-4-8-12(9-10)16-11-6-2-1-3-7-11/h1-9H,(H,14,15) |
| InChIKey | NXTDJHZGHOFSQG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-phenoxybenzoic acid (CHEBI:72631) has role human xenobiotic metabolite (CHEBI:76967) |
| 3-phenoxybenzoic acid (CHEBI:72631) has role marine xenobiotic metabolite (CHEBI:83399) |
| 3-phenoxybenzoic acid (CHEBI:72631) is a phenoxybenzoic acid (CHEBI:72633) |
| IUPAC Name |
|---|
| 3-phenoxybenzoic acid |
| Synonyms | Source |
|---|---|
| 3-carboxybiphenyl ether | ChEBI |
| 3-carboxydiphenyl ether | ChEBI |
| 3-PhOC6H4COOH | ChEBI |
| 3-PhOC6H4CO2H | ChEBI |
| diphenyl ether 3-carboxylic acid | ChEBI |
| m-carboxydiphenyl ether | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041807 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2105574 | Reaxys |
| CAS:3739-38-6 | ChemIDplus |
| Citations |
|---|