EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | CC/C=C\CC(O)/C=C/C=C\C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30O3/c1-2-3-13-16-19(21)17-14-11-9-7-5-4-6-8-10-12-15-18-20(22)23/h3-5,8-11,13-14,17,19,21H,2,6-7,12,15-16,18H2,1H3,(H,22,23)/b5-4-,10-8-,11-9-,13-3-,17-14+ |
| InChIKey | WLKCSMCLEKGITB-XWJJKCKWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS143) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-HEPE (CHEBI:72627) has role mouse metabolite (CHEBI:75771) |
| 15-HEPE (CHEBI:72627) is a HEPE (CHEBI:72799) |
| 15-HEPE (CHEBI:72627) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| Incoming Relation(s) |
| 15(R)-HEPE (CHEBI:91140) is a 15-HEPE (CHEBI:72627) |
| 15(S)-HEPE (CHEBI:88347) is a 15-HEPE (CHEBI:72627) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,13E,17Z)-15-hydroxyicosa-5,8,11,13,17-pentaenoic acid |
| Synonyms | Source |
|---|---|
| (±)-15-HEPE | LIPID MAPS |
| (±)-15-hydroxy-5Z,8Z,11Z,13E,17Z-eicosapentaenoic acid | LIPID MAPS |
| (5Z,8Z,11Z,13E,17Z)-15-hydroxyeicosa-5,8,11,13,17-pentaenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0010209 | HMDB |
| LMFA03070032 | LIPID MAPS |