EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO7 |
| Net Charge | 0 |
| Average Mass | 237.208 |
| Monoisotopic Mass | 237.08485 |
| SMILES | O=C(CO)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O |
| InChI | InChI=1S/C8H15NO7/c10-1-3-6(13)7(14)5(8(15)16-3)9-4(12)2-11/h3,5-8,10-11,13-15H,1-2H2,(H,9,12)/t3-,5-,6-,7-,8-/m1/s1 |
| InChIKey | KSWRTSFNOKOHBE-PNAXYBNRSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-glycoloyl-β-D-glucosamine (CHEBI:72626) has role epitope (CHEBI:53000) |
| N-glycoloyl-β-D-glucosamine (CHEBI:72626) is a N-acyl-hexosamine (CHEBI:21656) |
| N-glycoloyl-β-D-glucosamine (CHEBI:72626) is a N-acylglucosamine (CHEBI:21638) |
| N-glycoloyl-β-D-glucosamine (CHEBI:72626) is a amino monosaccharide (CHEBI:60926) |
| IUPAC Name |
|---|
| 2-deoxy-2-(glycoloylamino)-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| β-GlcN(Gc) | ChEBI |
| N-glycoloyl-β-D-glucosamine | ChEBI |
| GlcN(Gc)β | ChEBI |
| 2-deoxy-2-[(2-hydroxyacetyl)amino]-β-D-glucopyranose | ChEBI |
| β-D-glucopyranose, 2-deoxy-2-[(2-hydroxyacetyl)amino]- | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C03146 | KEGG COMPOUND |
| Citations |
|---|