EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23N5O5 |
| Net Charge | 0 |
| Average Mass | 365.390 |
| Monoisotopic Mass | 365.16992 |
| SMILES | CC(C)=CCNc1ncnc2c1ncn2[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H23N5O5/c1-8(2)3-4-17-14-10-15(19-6-18-14)21(7-20-10)16-13(25)12(24)11(23)9(5-22)26-16/h3,6-7,9,11-13,16,22-25H,4-5H2,1-2H3,(H,17,18,19)/t9-,11-,12+,13-,16+/m1/s1 |
| InChIKey | XEHLLUQVSRLWMH-HMXKMONRSA-N |
| Roles Classification |
|---|
| Biological Role: | cytokinin A phytohormone that promote cell division, or cytokinesis, in plant roots and shoots. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-(α-D-glucosyl)-N6-isopentenyladenine (CHEBI:72616) is a N-glycosyl compound (CHEBI:21731) |
| 9-(α-D-glucosyl)-N6-isopentenyladenine (CHEBI:72616) is a glucosyl-N6-isopentenyladenine (CHEBI:24289) |
| IUPAC Name |
|---|
| 9-(α-D-glucopyranosyl)-N-(3-methylbut-2-en-1-yl)-9H-purin-6-amine |
| Synonyms | Source |
|---|---|
| 9-α-D-glucopyranosyl-N6-isopentenyladenine | ChEBI |
| 9-(α-D-glucopyranosyl)-N6-isopentenyladenine | ChEBI |
| 9-α-D-glucosyl-N6-isopentenyladenine | ChEBI |
| Isopentenyladenine-9-N-glucoside | HMDB |
| Manual Xrefs | Databases |
|---|---|
| CPD-4603 | MetaCyc |
| HMDB0012240 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21539939 | Reaxys |