EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23N5O6 |
| Net Charge | 0 |
| Average Mass | 381.389 |
| Monoisotopic Mass | 381.16483 |
| SMILES | C/C(=C/CNc1ncnc2c1ncn2[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)CO |
| InChI | InChI=1S/C16H23N5O6/c1-8(4-22)2-3-17-14-10-15(19-6-18-14)21(7-20-10)16-13(26)12(25)11(24)9(5-23)27-16/h2,6-7,9,11-13,16,22-26H,3-5H2,1H3,(H,17,18,19)/b8-2-/t9-,11-,12+,13-,16+/m1/s1 |
| InChIKey | VYRAJOITMBSQSE-SBQJELAYSA-N |
| Roles Classification |
|---|
| Biological Role: | cytokinin A phytohormone that promote cell division, or cytokinesis, in plant roots and shoots. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-(α-D-glucosyl)-cis-zeatin (CHEBI:72607) is a N-glycosylzeatin (CHEBI:38645) |
| 9-(α-D-glucosyl)-cis-zeatin (CHEBI:72607) is a glucosyl-N6-isopentenyladenine (CHEBI:24289) |
| IUPAC Name |
|---|
| 9-(α-D-glucopyranosyl)-N-[(2Z)-4-hydroxy-3-methylbut-2-en-1-yl]-9H-purin-6-amine |
| Synonyms | Source |
|---|---|
| 9-(α-D-glucopyranosyl)-cis-zeatin | ChEBI |
| cis-zeatin-9-N-glucoside | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-4619 | MetaCyc |
| HMDB0012202 | HMDB |