EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O3 |
| Net Charge | 0 |
| Average Mass | 320.473 |
| Monoisotopic Mass | 320.23514 |
| SMILES | CCCCC/C=C\C=C\C(O)C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O3/c1-2-3-4-5-7-10-13-16-19(21)17-14-11-8-6-9-12-15-18-20(22)23/h6-7,9-11,13-14,16,19,21H,2-5,8,12,15,17-18H2,1H3,(H,22,23)/b9-6-,10-7-,14-11-,16-13+ |
| InChIKey | GCZRCCHPLVMMJE-RLZWZWKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS143) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-HETE (CHEBI:72606) has functional parent icosa-5,8,12,14-tetraenoic acid (CHEBI:36302) |
| 11-HETE (CHEBI:72606) has role mouse metabolite (CHEBI:75771) |
| 11-HETE (CHEBI:72606) is a HETE (CHEBI:36275) |
| 11-HETE (CHEBI:72606) is conjugate acid of 11-HETE(1−) (CHEBI:78833) |
| Incoming Relation(s) |
| 11(R)-HETE (CHEBI:34126) is a 11-HETE (CHEBI:72606) |
| 11(S)-HETE (CHEBI:138332) is a 11-HETE (CHEBI:72606) |
| 11-HETE(1−) (CHEBI:78833) is conjugate base of 11-HETE (CHEBI:72606) |
| IUPAC Name |
|---|
| (5Z,8Z,12E,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoic acid |
| Synonym | Source |
|---|---|
| 11-hydroxy-5Z,8Z,11E,14Z-eicosatetraenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA03060085 | LIPID MAPS |