EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26O3 |
| Net Charge | 0 |
| Average Mass | 266.381 |
| Monoisotopic Mass | 266.18819 |
| SMILES | CCCCC/C=C\C[C@@H](O)/C=C/C=C\CCC(=O)O |
| InChI | InChI=1S/C16H26O3/c1-2-3-4-5-6-9-12-15(17)13-10-7-8-11-14-16(18)19/h6-10,13,15,17H,2-5,11-12,14H2,1H3,(H,18,19)/b8-7-,9-6-,13-10+/t15-/m1/s1 |
| InChIKey | KBOVKDIBOBQLRS-QCNAHCIUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetranor-12R-HETE (CHEBI:72605) has role metabolite (CHEBI:25212) |
| tetranor-12R-HETE (CHEBI:72605) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| tetranor-12R-HETE (CHEBI:72605) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (4Z,6E,8R,10Z)-8-hydroxyhexadeca-4,6,10-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050143 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4312446 | Reaxys |