EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21N5O5 |
| Net Charge | 0 |
| Average Mass | 387.396 |
| Monoisotopic Mass | 387.15427 |
| SMILES | OC[C@H]1O[C@H](n2cnc3c(NCc4ccccc4)ncnc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H21N5O5/c24-7-11-13(25)14(26)15(27)18(28-11)23-9-22-12-16(20-8-21-17(12)23)19-6-10-4-2-1-3-5-10/h1-5,8-9,11,13-15,18,24-27H,6-7H2,(H,19,20,21)/t11-,13-,14+,15-,18+/m1/s1 |
| InChIKey | KRUUBWXADMDQSI-YYZLIPTLSA-N |
| Roles Classification |
|---|
| Biological Role: | cytokinin A phytohormone that promote cell division, or cytokinesis, in plant roots and shoots. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-benzyl-9-(α-D-glucosyl)adenine (CHEBI:72604) has functional parent adenine (CHEBI:16708) |
| N-benzyl-9-(α-D-glucosyl)adenine (CHEBI:72604) has role cytokinin (CHEBI:23530) |
| N-benzyl-9-(α-D-glucosyl)adenine (CHEBI:72604) is a N-glycosyl compound (CHEBI:21731) |
| N-benzyl-9-(α-D-glucosyl)adenine (CHEBI:72604) is a 6-alkylaminopurine (CHEBI:17524) |
| IUPAC Name |
|---|
| N-benzyl-9-(α-D-glucopyranosyl)-9H-purin-6-amine |
| Synonyms | Source |
|---|---|
| benzyladenine-9-N-glucoside | MetaCyc |
| N-benzyl-9-(α-D-glucopyranosyl)adenine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-4608 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21539944 | Reaxys |