EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H47NO9 |
| Net Charge | 0 |
| Average Mass | 625.759 |
| Monoisotopic Mass | 625.32508 |
| SMILES | [H][C@]12CC(=O)O[C@]([H])(C1)[C@H](C)/C=C/[C@@]1([H])O[C@]1(C)[C@@H](O)C[C@@]([H])([C@H](C)[C@@H](OC)/C(C)=C/C=C/C(C)=C/c1coc(C)n1)OC(=O)[C@]1([H])O[C@@]1([H])C2 |
| InChI | InChI=1S/C35H47NO9/c1-19(13-25-18-41-23(5)36-25)9-8-10-21(3)32(40-7)22(4)27-17-29(37)35(6)30(45-35)12-11-20(2)26-14-24(16-31(38)42-26)15-28-33(43-28)34(39)44-27/h8-13,18,20,22,24,26-30,32-33,37H,14-17H2,1-7H3/b9-8+,12-11+,19-13+,21-10+/t20-,22+,24+,26-,27+,28+,29+,30-,32+,33-,35-/m1/s1 |
| InChIKey | OWPCHSCAPHNHAV-QIPOKPRISA-N |
| Roles Classification |
|---|
| Biological Roles: | antimitotic Any compound that inhibits cell division (mitosis). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rhizoxin (CHEBI:72590) has role antimitotic (CHEBI:64911) |
| rhizoxin (CHEBI:72590) has role antineoplastic agent (CHEBI:35610) |
| rhizoxin (CHEBI:72590) has role metabolite (CHEBI:25212) |
| rhizoxin (CHEBI:72590) is a 1,3-oxazoles (CHEBI:46812) |
| rhizoxin (CHEBI:72590) is a epoxide (CHEBI:32955) |
| rhizoxin (CHEBI:72590) is a macrolide antibiotic (CHEBI:25105) |
| IUPAC Name |
|---|
| (1S,3S,5R,8S,10S,11R,13R,14E,16R,17R)-10-hydroxy-8-[(2S,3R,4E,6E,8E)-3-methoxy-4,8-dimethyl-9-(2-methyl-1,3-oxazol-4-yl)nona-4,6,8-trien-2-yl]-11,16-dimethyl-4,7,12,18-tetraoxatetracyclo[15.3.1.03,5.011,13]henicos-14-ene-6,19-dione |
| Synonyms | Source |
|---|---|
| WF-1360 | ChemIDplus |
| Antibiotic WF-1360 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5915392 | Reaxys |
| CAS:90996-54-6 | ChemIDplus |
| Citations |
|---|