EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C50H100N2O7 |
| Net Charge | 0 |
| Average Mass | 841.357 |
| Monoisotopic Mass | 840.75305 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCCCC(=O)N[C@@H](CN[C@H]1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@H](O)CCCCCCCCCCCCCC |
| InChI | InChI=1S/C50H100N2O7/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-24-25-26-27-29-31-33-35-37-39-46(55)52-43(41-51-42-40-45(54)49(58)50(59)48(42)57)47(56)44(53)38-36-34-32-30-28-16-14-12-10-8-6-4-2/h42-45,47-51,53-54,56-59H,3-41H2,1-2H3,(H,52,55)/t42-,43-,44+,45-,47-,48-,49+,50+/m0/s1 |
| InChIKey | XXEARWSQDQWKKF-KVWQTNEHSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| HS44 (CHEBI:72586) has role epitope (CHEBI:53000) |
| HS44 (CHEBI:72586) is a N-acyl-1-deoxy-4-hydroxysphinganine (CHEBI:67112) |
| HS44 (CHEBI:72586) is a amino cyclitol (CHEBI:61689) |
| IUPAC Name |
|---|
| N-[(2S,3S,4R)-3,4-dihydroxy-1-{[(1S,2S,3R,4R,5S)-2,3,4,5-tetrahydroxycyclohexyl]amino}octadecan-2-yl]hexacosanamide |
| Synonym | Source |
|---|---|
| HS44 aminocyclitol ceramide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| H4S | PDBeChem |
| Citations |
|---|