EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4N4O2 |
| Net Charge | 0 |
| Average Mass | 152.113 |
| Monoisotopic Mass | 152.03343 |
| SMILES | O=c1ncn(O)c2ncnc12 |
| InChI | InChI=1S/C5H4N4O2/c10-5-3-4(7-1-6-3)9(11)2-8-5/h1-2,11H,(H,6,7) |
| InChIKey | RVVZOZMPKROZAR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | alarm pheromone A pheromone which is released by an organism when damaged by a predator which warns other individuals that there is a danger. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypoxanthine 3-N-oxide (CHEBI:72574) has role alarm pheromone (CHEBI:72575) |
| hypoxanthine 3-N-oxide (CHEBI:72574) has role metabolite (CHEBI:25212) |
| hypoxanthine 3-N-oxide (CHEBI:72574) is a hydroxylamines (CHEBI:24709) |
| hypoxanthine 3-N-oxide (CHEBI:72574) is a oxopurine (CHEBI:25810) |
| hypoxanthine 3-N-oxide (CHEBI:72574) is a purine N-oxides (CHEBI:60341) |
| Incoming Relation(s) |
| schreckstoff (CHEBI:133299) has part hypoxanthine 3-N-oxide (CHEBI:72574) |
| IUPAC Name |
|---|
| 3-hydroxy-3,9-dihydro-6H-purin-6-one |
| Synonyms | Source |
|---|---|
| 3-hydroxyhypoxanthine | ChEBI |
| hypoxanthine 3-N-oxide | ChEBI |
| hypoxanthine 3-oxide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4992039 | Reaxys |
| CAS:19765-65-2 | ChemIDplus |
| Citations |
|---|