EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N5O8 |
| Net Charge | 0 |
| Average Mass | 411.371 |
| Monoisotopic Mass | 411.13901 |
| SMILES | CCC[C@H](Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C16H21N5O8/c1-2-3-11(15(23)19-12(16(24)25)6-7-14(17)22)18-10-5-4-9(20(26)27)8-13(10)21(28)29/h4-5,8,11-12,18H,2-3,6-7H2,1H3,(H2,17,22)(H,19,23)(H,24,25)/t11-,12-/m0/s1 |
| InChIKey | YHBIUNYOPJFAON-RYUDHWBXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dnp-Nor-Gln (CHEBI:72494) has part 2,4-dinitrophenyl group (CHEBI:53018) |
| Dnp-Nor-Gln (CHEBI:72494) has role epitope (CHEBI:53000) |
| Dnp-Nor-Gln (CHEBI:72494) is a dipeptide (CHEBI:46761) |
| IUPAC Names |
|---|
| DNP-Nor |
| N-(2,4-dinitrophenyl)-L-norvalyl-L-glutamine |
| Citations |
|---|