EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17N5O5 |
| Net Charge | 0 |
| Average Mass | 311.298 |
| Monoisotopic Mass | 311.12297 |
| SMILES | NC(=O)[C@@H](N)CCCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N5O5/c13-9(12(14)18)3-1-2-6-15-10-5-4-8(16(19)20)7-11(10)17(21)22/h4-5,7,9,15H,1-3,6,13H2,(H2,14,18)/t9-/m0/s1 |
| InChIKey | RTUBWEYSVHBUFM-VIFPVBQESA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-Dnp-Lys-NH2 (CHEBI:72492) has functional parent L-lysinamide (CHEBI:6263) |
| N6-Dnp-Lys-NH2 (CHEBI:72492) has part 2,4-dinitrophenyl group (CHEBI:53018) |
| N6-Dnp-Lys-NH2 (CHEBI:72492) has role epitope (CHEBI:53000) |
| N6-Dnp-Lys-NH2 (CHEBI:72492) is a amino acid amide (CHEBI:22475) |
| IUPAC Name |
|---|
| N6-(2,4-dinitrophenyl)-L-lysinamide |
| Synonym | Source |
|---|---|
| DNP-Lys | ChEBI |
| Citations |
|---|