EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17N5O8 |
| Net Charge | 0 |
| Average Mass | 383.317 |
| Monoisotopic Mass | 383.10771 |
| SMILES | CN(CC(=O)N[C@@H](CCC(N)=O)C(=O)O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17N5O8/c1-17(7-13(21)16-9(14(22)23)3-5-12(15)20)10-4-2-8(18(24)25)6-11(10)19(26)27/h2,4,6,9H,3,5,7H2,1H3,(H2,15,20)(H,16,21)(H,22,23)/t9-/m0/s1 |
| InChIKey | VQGOACFEXZKOMM-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dnp-Sar-Gln (CHEBI:72489) has part 2,4-dinitrophenyl group (CHEBI:53018) |
| Dnp-Sar-Gln (CHEBI:72489) has role epitope (CHEBI:53000) |
| Dnp-Sar-Gln (CHEBI:72489) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| N-(2,4-dinitrophenyl)-N-methylglycyl-L-glutamine |
| Synonyms | Source |
|---|---|
| DNP-Sar | ChEBI |
| N-(2,4-dinitrophenyl)-N-sarcosinyl-L-glutamine | ChEBI |
| Citations |
|---|