EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N4O7 |
| Net Charge | 0 |
| Average Mass | 312.238 |
| Monoisotopic Mass | 312.07060 |
| SMILES | NC(=O)CC[C@H](Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H12N4O7/c12-10(16)4-3-8(11(17)18)13-7-2-1-6(14(19)20)5-9(7)15(21)22/h1-2,5,8,13H,3-4H2,(H2,12,16)(H,17,18)/t8-/m0/s1 |
| InChIKey | OLIFDVJRECUYJH-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dnp-Gln (CHEBI:72487) has part 2,4-dinitrophenyl group (CHEBI:53018) |
| Dnp-Gln (CHEBI:72487) has role epitope (CHEBI:53000) |
| Dnp-Gln (CHEBI:72487) is a C-nitro compound (CHEBI:35716) |
| Dnp-Gln (CHEBI:72487) is a L-glutamine derivative (CHEBI:24317) |
| Dnp-Gln (CHEBI:72487) is a dicarboxylic acid monoamide (CHEBI:35735) |
| IUPAC Name |
|---|
| N2-(2,4-dinitrophenyl)-L-glutamine |
| Synonyms | Source |
|---|---|
| DNP-Glu | ChEBI |
| N2-(2,4-Dinitrophenyl)-L-glutamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| US2011092557 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3122983 | Reaxys |
| CAS:1602-41-1 | ChemIDplus |
| Citations |
|---|