EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N6O9 |
| Net Charge | 0 |
| Average Mass | 426.342 |
| Monoisotopic Mass | 426.11353 |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@H](CC(N)=O)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C15H18N6O9/c16-12(22)4-3-9(15(25)26)19-14(24)10(6-13(17)23)18-8-2-1-7(20(27)28)5-11(8)21(29)30/h1-2,5,9-10,18H,3-4,6H2,(H2,16,22)(H2,17,23)(H,19,24)(H,25,26)/t9-,10-/m0/s1 |
| InChIKey | VLAKYRWCMVUMIC-UWVGGRQHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dnp-Asn-Gln (CHEBI:72486) has part 2,4-dinitrophenyl group (CHEBI:53018) |
| Dnp-Asn-Gln (CHEBI:72486) has role epitope (CHEBI:53000) |
| Dnp-Asn-Gln (CHEBI:72486) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| N2-(2,4-dinitrophenyl)-L-asparaginyl-L-glutamine |
| Synonym | Source |
|---|---|
| DPN-Asn | ChEBI |
| Citations |
|---|