EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H23N7O13 |
| Net Charge | 0 |
| Average Mass | 641.506 |
| Monoisotopic Mass | 641.13538 |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@H](Cc1ccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C26H23N7O13/c27-24(34)10-8-19(26(36)37)29-25(35)20(28-18-7-3-15(30(38)39)12-21(18)32(42)43)11-14-1-5-17(6-2-14)46-23-9-4-16(31(40)41)13-22(23)33(44)45/h1-7,9,12-13,19-20,28H,8,10-11H2,(H2,27,34)(H,29,35)(H,36,37)/t19-,20-/m0/s1 |
| InChIKey | YYSIIHNUKRSEDJ-PMACEKPBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,O-(Dnp)2-Tyr-Gln (CHEBI:72484) has part 2,4-dinitrophenyl group (CHEBI:53018) |
| N,O-(Dnp)2-Tyr-Gln (CHEBI:72484) has role epitope (CHEBI:53000) |
| N,O-(Dnp)2-Tyr-Gln (CHEBI:72484) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| N,O-bis(2,4-dinitrophenyl)-L-tyrosyl-L-glutamine |
| Synonym | Source |
|---|---|
| DNP2-Tyr | ChEBI |
| Citations |
|---|