EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4FN5 |
| Net Charge | 0 |
| Average Mass | 153.120 |
| Monoisotopic Mass | 153.04507 |
| SMILES | Nc1nc(F)nc2ncnc12 |
| InChI | InChI=1S/C5H4FN5/c6-5-10-3(7)2-4(11-5)9-1-8-2/h1H,(H3,7,8,9,10,11) |
| InChIKey | WKMPTBDYDNUJLF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-fluoroadenine (CHEBI:72457) has role antineoplastic agent (CHEBI:35610) |
| 2-fluoroadenine (CHEBI:72457) is a organofluorine compound (CHEBI:37143) |
| 2-fluoroadenine (CHEBI:72457) is a purines (CHEBI:26401) |
| Incoming Relation(s) |
| fludarabine phosphate (CHEBI:63599) has functional parent 2-fluoroadenine (CHEBI:72457) |
| IUPAC Name |
|---|
| 2-fluoro-7H-purin-6-amine |
| Synonyms | Source |
|---|---|
| 2-Fad | ChemIDplus |
| SRI 774 | ChemIDplus |
| 2-fluoro-6-aminopurine | ChemIDplus |
| 2-fluoro-1H-purin-6-amine | ChemIDplus |
| BRN 0610958 | ChemIDplus |
| NSC 27364 | ChemIDplus |
| Citations |
|---|