EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H34O6 |
| Net Charge | 0 |
| Average Mass | 442.552 |
| Monoisotopic Mass | 442.23554 |
| SMILES | [H][C@@]12[C@H](C)CC[C@@]1([H])[C@]1(C)O[C@@](C(C)C)(C[C@H]1OC(=O)CO)[C@H]2OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C26H34O6/c1-16(2)26-14-20(30-22(29)15-27)25(4,32-26)19-12-10-17(3)23(19)24(26)31-21(28)13-11-18-8-6-5-7-9-18/h5-9,11,13,16-17,19-20,23-24,27H,10,12,14-15H2,1-4H3/b13-11+/t17-,19-,20-,23-,24+,25+,26-/m1/s1 |
| InChIKey | GACOFEKSDCOVMV-RRYXBOBMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| englerin A (CHEBI:72441) has role antineoplastic agent (CHEBI:35610) |
| englerin A (CHEBI:72441) has role metabolite (CHEBI:25212) |
| englerin A (CHEBI:72441) is a cinnamate ester (CHEBI:36087) |
| englerin A (CHEBI:72441) is a glycolate ester (CHEBI:37938) |
| englerin A (CHEBI:72441) is a guaiane sesquiterpenoid (CHEBI:36744) |
| IUPAC Name |
|---|
| (1R,3aR,4S,5R,7R,8S,8aR)-5-(glycoloyloxy)-7-isopropyl-1,4-dimethyldecahydro-4,7-epoxyazulen-8-yl (2E)-3-phenylacrylate |
| Manual Xrefs | Databases |
|---|---|
| US2010286259 | Patent |
| WO2009088854 | Patent |
| WO2011120886 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21475559 | Reaxys |
| Citations |
|---|